- L-Lysine Diisocyanate
-
- $150.00
-
2025-05-23
- CAS:45172-15-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 500kg
- L-Lysine Diisocyanate
-
- $150.00
-
2025-05-23
- CAS:45172-15-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 500kg
|
| | L-Lysine Diisocyanate Basic information |
| Product Name: | L-Lysine Diisocyanate | | Synonyms: | (S)-Ethyl 2,6-diisocyanatohexanoate;Diisocyanate Ethyl Caproate;2,6-DiisocyanatoEthylCaproate;EthylEsterL-LysineDiisocyanate;Ethyl (S)-2,6-diisocyanatohexanoate;L-Lysine diisocyanate ethyl ester;lysine diisocyanate;Hexanoic acid,2,6-diisocyanato-, ethyl ester, (2S)- | | CAS: | 45172-15-4 | | MF: | C10H14N2O4 | | MW: | 226.23 | | EINECS: | 630-601-9 | | Product Categories: | | | Mol File: | 45172-15-4.mol |  |
| | L-Lysine Diisocyanate Chemical Properties |
| Boiling point | 305.0±37.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | refractive index | 1.4572 | | storage temp. | 2-8°C, stored under nitrogen | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) | | form | Viscous Liquid | | color | Yellow to brown | | Optical Rotation | -20.9450°(C=1g/100mL, Dioxane, 20°C, 589nm) | | Water Solubility | Sparingly soluble in water (0.19 g/L). | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C10H14N2O4/c1-2-16-10(15)9(12-8-14)5-3-4-6-11-7-13/h9H,2-6H2,1H3/t9-/m0/s1 | | InChIKey | IGWTZHMYJZZIGC-VIFPVBQESA-N | | SMILES | C(OCC)(=O)[C@@H](N=C=O)CCCCN=C=O |
| RIDADR | UN2206 | | HazardClass | 6.1 |
| | L-Lysine Diisocyanate Usage And Synthesis |
| Uses | It is an important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field. |
| | L-Lysine Diisocyanate Preparation Products And Raw materials |
|