|
|
| | 2-Chloro-4-(trifluoromethyl)benzonitrile Basic information |
| | 2-Chloro-4-(trifluoromethyl)benzonitrile Chemical Properties |
| Melting point | 82-83°C/8mm | | Boiling point | 192-193 °C(lit.) | | density | 1.389 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4840(lit.) | | Fp | >220 °F | | storage temp. | Sealed in dry,Room Temperature | | form | fused solid | | color | White | | InChI | InChI=1S/C8H3ClF3N/c9-7-3-6(8(10,11)12)2-1-5(7)4-13/h1-3H | | InChIKey | GEHMLBFNZKJDQM-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(C(F)(F)F)C=C1Cl | | CAS DataBase Reference | 1813-33-8(CAS DataBase Reference) |
| Hazard Codes | Xn,T,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37/39-36 | | RIDADR | 3276 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2926907090 | | Storage Class | 10 - Combustible liquids |
| | 2-Chloro-4-(trifluoromethyl)benzonitrile Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 2-Chloro-4-trifluoromethylbenzonitrile (cas# 1813-33-8) is a compound useful in organic synthesis. |
| | 2-Chloro-4-(trifluoromethyl)benzonitrile Preparation Products And Raw materials |
|