| Company Name: |
Zhengzhou Converging Chemical Co. LTD
|
| Tel: |
0371-53399770 18037166334 |
| Email: |
3857571523@qq.com |
| Products Intro: |
Product Name:2,4-DIPHENYLTHIAZOLE
CAS:1826-14-8
Purity:98% Package:100mg;250mg;1g;5g;10g;25g;100g
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:2,4-Diphenylthiazole
|
|
| | 2,4-DIPHENYLTHIAZOLE Basic information |
| | 2,4-DIPHENYLTHIAZOLE Chemical Properties |
| Melting point | 92.5°C | | density | 1.1554 | | refractive index | 1.5300 (estimate) | | form | solid | | InChI | 1S/C15H11NS/c1-3-7-12(8-4-1)14-11-17-15(16-14)13-9-5-2-6-10-13/h1-11H | | InChIKey | MIECVJDZXBUVSN-UHFFFAOYSA-N | | SMILES | C1(C2=CSC(C3=CC=CC=C3)=N2)=CC=CC=C1 |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Chronic 4
Eye Dam. 1 |
| | 2,4-DIPHENYLTHIAZOLE Usage And Synthesis |
| | 2,4-DIPHENYLTHIAZOLE Preparation Products And Raw materials |
|