|
|
| | 6-Bromo-imidazo[1,2-a]pyrimidine Basic information |
| | 6-Bromo-imidazo[1,2-a]pyrimidine Chemical Properties |
| Melting point | 215-216° | | density | 1.89±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | pka | 3.80±0.30(Predicted) | | color | White to Orange to Green | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C6H4BrN3/c7-5-3-9-6-8-1-2-10(6)4-5/h1-4H | | InChIKey | BQMWMOQCMFLRQQ-UHFFFAOYSA-N | | SMILES | C12=NC=CN1C=C(Br)C=N2 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 6-Bromo-imidazo[1,2-a]pyrimidine Usage And Synthesis |
| Synthesis | 2-Amino-5-bromopyridine (3.0 g, 17.2 mmol) and bromoacetaldehyde diethyl acetal (3.2 mL, 20.7 mmol) were suspended in ethanol and 48% hydrobromic acid (1.7 mL) was added. The mixture was transferred to a sealed tube and reacted at 80 °C for 16 hours. Upon completion of the reaction, it was cooled to room temperature and the pH was adjusted to about 12 with 6N sodium hydroxide solution. the resulting precipitate was collected by filtration, washed sequentially with water and hexane, and dried to a constant weight to afford 6-bromoimidazo[1,2-A]pyrimidine 2.12 g (62% yield) as a white solid. Mass spectrum (electrospray ionization) m/e 199.7 [M + H]+. | | References | [1] Patent: WO2008/14219, 2008, A2. Location in patent: Page/Page column 48 |
| | 6-Bromo-imidazo[1,2-a]pyrimidine Preparation Products And Raw materials |
|