|
|
| | 2,4-Dichloro-5-sulfamoylbenzoic acid Basic information |
| | 2,4-Dichloro-5-sulfamoylbenzoic acid Chemical Properties |
| Melting point | 230-232 °C (dec.)(lit.) | | Boiling point | 503.8±60.0 °C(Predicted) | | density | 1.5426 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | pka | 2.08±0.25(Predicted) | | form | Solid | | color | White to Off-White | | Water Solubility | insoluble | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C7H5Cl2NO4S/c8-4-2-5(9)6(15(10,13)14)1-3(4)7(11)12/h1-2H,(H,11,12)(H2,10,13,14) | | InChIKey | ZSHHRBYVHTVRFK-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(S(N)(=O)=O)=C(Cl)C=C1Cl | | CAS DataBase Reference | 2736-23-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | DG8100000 | | HS Code | 29350090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 | | Toxicity | mouse,LD50,intraperitoneal,15gm/kg (15000mg/kg),Pharmaceutical Chemistry Journal Vol. 19, Pg. 697, 1985. |
| | 2,4-Dichloro-5-sulfamoylbenzoic acid Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder | | Uses | 2,4-Dichloro-5-sulfamoylbenzoic Acid is a chlorinated sulfamoylbenzoic acid with diuretic acid. |
| | 2,4-Dichloro-5-sulfamoylbenzoic acid Preparation Products And Raw materials |
|