|
|
| | Tin fluoroborate Basic information |
| | Tin fluoroborate Chemical Properties |
| Melting point | >130°C (dec.) | | density | 1.67 g/mL at 25 °C | | form | Liquid | | color | Colorless | | Specific Gravity | 1.67 | | Odor | Odorless | | Water Solubility | Miscible with water. | | Hydrolytic Sensitivity | 0: forms stable aqueous solutions | | Exposure limits | ACGIH: TWA 2 mg/m3; TWA 2.5 mg/m3
NIOSH: IDLH 100 mg/m3; IDLH 250 mg/m3; TWA 2 mg/m3 | | InChI | InChI=1S/2BF4.Sn/c2*2-1(3,4)5;/q2*-1;+2 | | InChIKey | JPZSNSDMGTYJIW-UHFFFAOYSA-N | | SMILES | [B-](F)(F)(F)F.[B-](F)(F)(F)F.[Sn+2] | | CAS DataBase Reference | 13814-97-6(CAS DataBase Reference) | | EPA Substance Registry System | Borate(1-), tetrafluoro-, tin(2+) (2:1) (13814-97-6) |
| Hazard Codes | C | | Risk Statements | 31-34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3264 8/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2826908090 |
| | Tin fluoroborate Usage And Synthesis |
| Chemical Properties | only available as a solution, e.g. 47% w; prepared by dissolution of SnO in fluoroboric acid; used in tin and tin-lead plating baths [KIR83] | | Uses | Tin(II) tetrafluoroborate is used in electroplating. It is also used for plating bath tinned copper, tin and tin alloy. Further, it acts as a catalyst for various organic reactions. It is also employed in metal plating. In addition to this, it is used as a petrochemical additive. |
| | Tin fluoroborate Preparation Products And Raw materials |
|