| Company Name: |
Dalian Meilun Biotech Co., Ltd.
|
| Tel: |
0411-62910999 13889544652 |
| Email: |
sales@meilune.com |
| Products Intro: |
Product Name:Carbomer 940 Purity:V Package:100g
|
|
| | 1.10-Phenanthroline Basic information |
| Product Name: | 1.10-Phenanthroline | | Synonyms: | 1-Chloro-2.4-nitrrobenzene;1-naphthyl phosphate sodium;1-Ocane sulfonic acid sodium;2.6-Dichoropheno indophenol,Na salt;3-Mercaptoprppionic;4-NPP,Na2;decanesulfonic acid sodium;Dimethylamino naphthalene-5-sulfonyl chloride | | CAS: | 1485-17-2 | | MF: | C12H8N2 | | MW: | 180.20532 | | EINECS: | 919-121-3 | | Product Categories: | | | Mol File: | 1485-17-2.mol |  |
| | 1.10-Phenanthroline Chemical Properties |
| InChI | InChI=1S/C12H8N2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1/h1-8H | | InChIKey | DGEZNRSVGBDHLK-UHFFFAOYSA-N | | SMILES | C12=NC=CC=C1C=CC1C2=NC=CC=1 |
| | 1.10-Phenanthroline Usage And Synthesis |
| | 1.10-Phenanthroline Preparation Products And Raw materials |
|