|
|
| | 2-(2-Hydroxy)ethyl-p-phenylene diamino sulfate Basic information |
| Product Name: | 2-(2-Hydroxy)ethyl-p-phenylene diamino sulfate | | Synonyms: | hydroxyethyl-p-phenylenediamine sulphate;2-(2-HYDROXY)ETHYL-P-PHENYLENE DIAMINO SULFATE;2,5-Diaminophenylethanolsulfate;Hydroxyethyl-p-phenylenediaminesulfatephenylenediaminesulfate(2,5-Diaminophenylethanolsulfate);2-(2-Hydroxy)ethyl-p-phenylene;Benzeneethanol, 2,5-diamino-, sulfate (1:1) (salt);2-(2-HYDROXY)ETHYL-4-PHENYLENEDIAMINOSULFATE;2-(2-Hydroxyethyl)-p-phenylenediamine sulfate | | CAS: | 93841-25-9 | | MF: | C8H14N2O5S | | MW: | 250.27 | | EINECS: | 298-995-1 | | Product Categories: | API intermediates | | Mol File: | 93841-25-9.mol |  |
| | 2-(2-Hydroxy)ethyl-p-phenylene diamino sulfate Chemical Properties |
| Melting point | >240℃ | | vapor pressure | 0Pa at 20℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Light Purple | | Water Solubility | 51.2g/L at 20℃ | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | HAIR DYEING | | InChI | InChI=1S/C8H12N2O.H2O4S/c9-7-1-2-8(10)6(5-7)3-4-11;1-5(2,3)4/h1-2,5,11H,3-4,9-10H2;(H2,1,2,3,4) | | InChIKey | VBSLNFWECRRALP-UHFFFAOYSA-N | | SMILES | S(O)(O)(=O)=O.C(C1C=C(N)C=CC=1N)CO | | LogP | 0.24 at 20℃ | | CAS DataBase Reference | 93841-25-9(CAS DataBase Reference) |
| | 2-(2-Hydroxy)ethyl-p-phenylene diamino sulfate Usage And Synthesis |
| Chemical Properties | Off-white and light pink powder | | Flammability and Explosibility | Not classified |
| | 2-(2-Hydroxy)ethyl-p-phenylene diamino sulfate Preparation Products And Raw materials |
|