|
|
| | trans-4-Cyclohexyl-L-proline Basic information |
| Product Name: | trans-4-Cyclohexyl-L-proline | | Synonyms: | L-Proline, 4-cyclohexyl-, (4S)-;H-Chpro-OH;TRANS-4-CYCLOHEXYL-L-PROLINE (FOSINOPRIL''S INTERMEDIATE 2);trans-4-Cyclohexyl-L-proline;Fosinopril Intermediate 2;(2S,4S)-4-cyclohexylpyrrolidine-2-carboxylic acid;(4S)- 4-cyclohexyl-L-Proline;H-Chpro-OH【trans-4-Cyclohexyl-L-proline】 | | CAS: | 103201-78-1 | | MF: | C11H19NO2 | | MW: | 197.27 | | EINECS: | 600-406-3 | | Product Categories: | | | Mol File: | 103201-78-1.mol |  |
| | trans-4-Cyclohexyl-L-proline Chemical Properties |
| Melting point | 260-262 °C(Solv: methanol (67-56-1); ethyl ether (60-29-7)) | | Boiling point | 343.9±35.0 °C(Predicted) | | density | 1.113±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 2.35±0.40(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | -30.2°(C=0.011192 g/mL ACOH) | | InChI | InChI=1S/C11H19NO2/c13-11(14)10-6-9(7-12-10)8-4-2-1-3-5-8/h8-10,12H,1-7H2,(H,13,14)/t9-,10+/m1/s1 | | InChIKey | XRZWVSXEDRYQGC-ZJUUUORDSA-N | | SMILES | C(O)(=O)[C@@H]1C[C@@H](C2CCCCC2)CN1 | | CAS DataBase Reference | 103201-78-1(CAS DataBase Reference) |
| | trans-4-Cyclohexyl-L-proline Usage And Synthesis |
| Synthesis | The general procedure for the synthesis of (2S,4S)-4-cyclohexylpyrrolidine-2-carboxylic acid from (2S,4S)-4-phenylpyrrolidine-2-carboxylic acid was as follows: compound V (1.2 g), 5% rhodium-carbon catalyst (0.24 g), concentrated hydrochloric acid (1.2 ml), and methanol (12 ml) were added to the reaction flask sequentially. The reaction mixture was stirred and hydrogenated at 30 °C under 2.0 MPa hydrogen pressure. After 2 hours of reaction, the reaction mixture was filtered under reduced pressure. The filtrate was concentrated under reduced pressure to give a white solid product (1.11 g) in 90.0% yield. | | References | [1] Patent: CN107365268, 2017, A. Location in patent: Paragraph 0016 |
| | trans-4-Cyclohexyl-L-proline Preparation Products And Raw materials |
|