|
|
| | 2,6-Ntp Basic information |
| Product Name: | 2,6-Ntp | | Synonyms: | 2,6-Ntp;2,6-DiMethyl-4-(2-nitrosophenyl)-3,5-pyridinedicarboxylic Acid 3,5-DiMethyl Ester
2,6-DiMethyl-3,5-dicarboMethoxy-4-(2-nitrosophenyl)pyridine;4-(2-Nitrosophenyl)-2,6-diMethyl-3,5-diMethoxycarbonylpyridine;Dimethyl 2,6-dimethyl-4-(2-nitrosophenyl)-3,5-pyridinedicarboxylate;Nifedipine Nitrosophenylpyridine Analog;dimethyl 2,6-dimethyl-4-(2-nitrosophenyl)pyridine-3,5-dicarboxylate;2,6-dimethyl-4-(2'-nitrosophenyl)-3,5-pyridinedicarboxylic acid dimethyl ester;Nifedipine impurity B (EP) | | CAS: | 50428-14-3 | | MF: | C17H16N2O5 | | MW: | 328.32 | | EINECS: | | | Product Categories: | Aromatics;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 50428-14-3.mol |  |
| | 2,6-Ntp Chemical Properties |
| Melting point | 93℃ | | Boiling point | 449.0±45.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 1.86±0.29(Predicted) | | form | solid | | Major Application | pharmaceutical
pharmaceutical small molecule | | InChI | 1S/C17H16N2O5/c1-9-13(16(20)23-3)15(11-7-5-6-8-12(11)19-22)14(10(2)18-9)17(21)24-4/h5-8H,1-4H3 | | InChIKey | MUZLTKGYFZENFW-UHFFFAOYSA-N | | SMILES | O=C(OC)C1=C(C2=C(N=O)C=CC=C2)C(C(OC)=O)=C(C)N=C1C |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2933399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,6-Ntp Usage And Synthesis |
| Uses | A photodegradation product of Nifedipine (N457000). Shown to relax contractions of the rat aortic strip induced by norepinephrine and other agonists. |
| | 2,6-Ntp Preparation Products And Raw materials |
|