- Boc-Arg(Mtr)-OH
-
- $0.00 / 1Box
-
2026-01-04
- CAS:102185-38-6
- Min. Order: 1Box
- Purity: 99%
- Supply Ability: 200kg
- BOC-ARG(MTS)-OH
-
- $1.10 / 1g
-
2025-06-25
- CAS:102185-38-6
- Min. Order: 1g
- Purity: 99.0% min
- Supply Ability: 100 tons min
- BOC-ARG(MTS)-OH
-
- $1.00 / 1KG
-
2019-07-06
- CAS:102185-38-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1ton
|
| | BOC-ARG(MTS)-OH Basic information |
| Product Name: | BOC-ARG(MTS)-OH | | Synonyms: | NA-BOC-NW-(4-METHOXY-2,3,6-TRIMETHYL-BENZENE-SULFONYL)-L-ARGININE;N-α-Boc-N-ω-4-methoxy-2,3,6-trimethyl;N(ALPHA)-BOC-N(OMEGA)-MTR-L-ARGININE;NA-T-BOC-N-OMEGA-(4-METHOXY-2,3,6-TRIMET HYLBENZENE;BOC-L-ARG(MTS);BOC-L-ARG(MTS)-OH;BOC-L-ARGININE (MTS);BOC-N-OMEGA-(MESITYLENE-2-SULFONYL)-L-ARGININE | | CAS: | 102185-38-6 | | MF: | C21H34N4O7S | | MW: | 486.58 | | EINECS: | | | Product Categories: | Amino Acids | | Mol File: | 102185-38-6.mol |  |
| | BOC-ARG(MTS)-OH Chemical Properties |
| density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | Soluble in water or 1% acetic acid | | pka | 3.95±0.21(Predicted) | | form | Powder | | color | White to off-ehite | | Major Application | peptide synthesis | | InChIKey | CXZHJRGYWGPJSD-HNNXBMFYSA-N | | SMILES | [S](=O)(=O)(N\C(=[N+H]\CCC[C@H](NC(=O)OC(C)(C)C)C(=O)[O-])\N)c1c(c(c(cc1C)OC)C)C |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-40 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 2935 90 90 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | BOC-ARG(MTS)-OH Usage And Synthesis |
| Chemical Properties | white powder | | Uses | The Mtr-guanidine protection of Arg is more easily cleaved with acid than the tosyl protection | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-ARG(MTS)-OH Preparation Products And Raw materials |
|