|
|
| | Desoxypodophyllotoxin Basic information |
| Product Name: | Desoxypodophyllotoxin | | Synonyms: | Desoxypodophyllotoxin;anthric;Anthricin/Deoxypodophyllotoxin;4-Deoxypodophyllotoxin;Furo[3',4':6,7]naphtho[2,3-D]-1,3-dioxol-6(5ah)-one, 5,8,8A,9-tetrahydro-5-(3,4,5-trimethoxyphenyl)-,(5R,5ar,8ar)-;Nsc403148;Deoxypodophyllotoxin, deoxypodophyllotoxin;Podophyllotoxin 9-Desoxy Impurity | | CAS: | 19186-35-7 | | MF: | C22H22O7 | | MW: | 398.41 | | EINECS: | | | Product Categories: | | | Mol File: | 19186-35-7.mol |  |
| | Desoxypodophyllotoxin Chemical Properties |
| storage temp. | Store at 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | Boiling point | 564.5±50.0 °C(Predicted) | | density | 1.304±0.06 g/cm3(Predicted) | | Melting point | 168 °C | | color | White to off-white | | Stability: | Hygroscopic | | InChI | InChI=1S/C22H22O7/c1-24-17-6-12(7-18(25-2)21(17)26-3)19-14-8-16-15(28-10-29-16)5-11(14)4-13-9-27-22(23)20(13)19/h5-8,13,19-20H,4,9-10H2,1-3H3/t13-,19+,20-/m0/s1 | | InChIKey | ZGLXUQQMLLIKAN-SVIJTADQSA-N | | SMILES | O1C2=CC3=C(C=C2OC1)[C@@H](C1=CC(OC)=C(OC)C(OC)=C1)[C@@]1([H])C(=O)OC[C@]1([H])C3 |
| | Desoxypodophyllotoxin Usage And Synthesis |
| Chemical Properties | Colorless prismatic crystals (anhydrous ethanol), soluble in methanol, ethanol, DMSO and other organic solvents, from the rhizomes of Sinopodophyllum hexandrum (Royle) Ying; Dysosma versipellis (Hance) M. Cheng ex Ying. | | Uses | 4-Deoxypodophyllotoxin is a medicinal herb product isolated from Anthriscus sylvestris Hoffm. It is well known for its antitumor, antiviral, and anti-inflammatory activities. 4-Deoxypodophyllotoxin wa
s also shown to inhibit the passive cutaneous anaphylaxis reaction. | | Definition | ChEBI: A member of the class of furonaphthodioxoles that is (5R,5aR,8aR)-5,8,8a,9-tetrahydro-2H-furo[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6(5aH)-one substituted a
position 5 by a 3,4,5-trimethoxyphenyl group. | | in vivo | Deoxypodophyllotoxin (intravenously injected; 5, 10, and 20 mg/kg; 3 times a week; 28 days) suppresses the tumors in a dose-dependent manner, the growth of tumors is inhibited by 22.19%, 47.91% and 50.93% with DPT at 5, 10 and 20 mg/kg, respectively[1]. | Animal Model: | Xenograft model of gastric cancer in nude mice with SGC-7901 cells[1] | | Dosage: | 5, 10, and 20 mg/kg | | Administration: | Intravenously injected; 5, 10, and 20 mg/kg; 3 times a week; 28 days | | Result: | Inhibited the growth of gastric cancer tumors. |
|
| | Desoxypodophyllotoxin Preparation Products And Raw materials |
|