|
|
| | Ethyl (R)-nipecotate L-tartarate Basic information |
| | Ethyl (R)-nipecotate L-tartarate Chemical Properties |
| Melting point | 157-159 °C (lit.) | | alpha | 10 º (c=5, H2O) | | refractive index | 10.3 ° (C=5, H2O) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Methanol, Water | | form | Solid | | color | White Cyrstalline | | Optical Rotation | [α]20/D +10°, c = 5 in H2O | | InChI | 1S/C8H15NO2.C4H6O6/c1-2-11-8(10)7-4-3-5-9-6-7;5-1(3(7)8)2(6)4(9)10/h7,9H,2-6H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t7-;1-,2-/m11/s1 | | InChIKey | HHPGQKZOPPDLNH-NWAAXCJESA-N | | SMILES | O[C@H]([C@@H](O)C(O)=O)C(O)=O.CCOC(=O)[C@@H]1CCCNC1 | | CAS DataBase Reference | 167392-57-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26-36-39 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Ethyl (R)-nipecotate L-tartarate Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Ethyl (R)-Nipecotate, L-Tartrate (cas# 167392-57-6) is a compound useful in organic synthesis. |
| | Ethyl (R)-nipecotate L-tartarate Preparation Products And Raw materials |
|