| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | 17-(3-pyridyl)androsta-5,16-dien-3-one Basic information |
| Product Name: | 17-(3-pyridyl)androsta-5,16-dien-3-one | | Synonyms: | 17-(3-pyridyl)androsta-5,16-dien-3-one;7-(3-pyridyl)androsta-5,16-dien-3-one;17-(3-pyridinyl)-androsta-4,16-diene-3-one;D4-abiraterone (CB-7627);D4-abiraterone;Abiraterone 3-Oxo 4,5-Dihydro Impurity/(8R,9S,10R,13S,14S)-10,13-Dimethyl-17-(pyridin-3-yl)-1,7,8,9,10,11,12,13,14,15-decahydro-2H-cyclopenta[a]phenanthren-3(6H)-one;Abiraterone (D4A);Δ4-Abiraterone | | CAS: | 154229-21-7 | | MF: | C24H29NO | | MW: | 347.49 | | EINECS: | | | Product Categories: | | | Mol File: | 154229-21-7.mol |  |
| | 17-(3-pyridyl)androsta-5,16-dien-3-one Chemical Properties |
| Boiling point | 504.6±50.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 10 mg/ml | | form | powder | | pka | 5.32±0.12(Predicted) | | color | white to beige | | InChIKey | GYJZZAJJENTSTP-NHFPKVKZSA-N | | SMILES | n1cc(ccc1)C2=CC[C@H]3[C@H]4[C@@H]([C@]5(CCC(=O)C=C5CC4)C)CC[C@@]32C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 17-(3-pyridyl)androsta-5,16-dien-3-one Usage And Synthesis |
| Uses | 17-(3-Pyridinyl)-androsta-4,16-dien-3-one is a possible steroidal inhibitor of human cytochrome P 45017α-hydroxylase-C17,20-lyase. | | Biological Activity | D4A (Δ4-Abiraterone; 3-Pyridinyl)-androsta-4,16-dien-3-one) is an abiraterone metabolite found to be more active than abiraterone. Abiraterone is a potent, selective, and orally bioavailable inhibitor of CYP17A1 (CYP450c17), an enzyme th at catalyzes two key serial reactions (17 alpha hydroxylase and 17,20 lyase) in androgen and estrogen biosynthesis resulting in the formation of DHEA and androstenedione, which may ultimately be metabolized into testosterone. CYP17 is the key enzyme for androgen biosynthesis in both the testes and adrenals, so its inhibition can stop the production of androgens in both places. It is approved for the treatment of metastatic castration-resistant prostate cancer. D4A blocks not only CYP17A1, but also blocks two other enzymes, 3-hydroxysteroid dehydrogenase (3HSD) and steroid-5-reductase (SRD5A), which are involved in producing the androgen 5-dihydrotestosterone (DHT), while also blocking the androgen receptor. | | in vivo | D4-abiraterone is tenfold more potent than Abiraterone in blocking conversion from dehydroepiandrosterone (DHEA) by 3β-hydroxysteroid dehydrogenase (3βHSD) to D4-androstenedione (AD) in LNCaP and VCaP xenografts. 0.1 μM D4-abiraterone is equivalent to 1 μM Abiraterone for blocking AD accumulation at 48 h in both LNCaP and VCaP xenografts. Progression is significantly delayed in the D4-abiraterone group compare with the Abiraterone acetate group[1]. | | IC 50 | CYP17 |
| | 17-(3-pyridyl)androsta-5,16-dien-3-one Preparation Products And Raw materials |
|