- dicyclohexylmethane
-
- $6000.00
-
2019-07-06
- CAS:3178-23-2
- Min. Order: 100G
- Purity: 98%
- Supply Ability: 10KG
|
| | dicyclohexylmethane Basic information |
| Product Name: | dicyclohexylmethane | | Synonyms: | dicyclohexylmethane;1,1'-Methylenebiscyclohexane;cyclohexylmethylcyclohexane;Cyclohexane, 1,1'-methylenebis- | | CAS: | 3178-23-2 | | MF: | C13H24 | | MW: | 180.33 | | EINECS: | | | Product Categories: | 1 | | Mol File: | 3178-23-2.mol |  |
| | dicyclohexylmethane Chemical Properties |
| Melting point | -18.64°C | | Boiling point | 252.85°C | | density | 0.8730 | | refractive index | 1.4743 | | InChI | InChI=1S/C13H24/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h12-13H,1-11H2 | | InChIKey | XXKOQQBKBHUATC-UHFFFAOYSA-N | | SMILES | C(C1CCCCC1)C1CCCCC1 |
| | dicyclohexylmethane Usage And Synthesis |
| | dicyclohexylmethane Preparation Products And Raw materials |
|