|
|
| | 3-(5-nitrofurfurylideneamino)hydantoic acid Basic information |
| Product Name: | 3-(5-nitrofurfurylideneamino)hydantoic acid | | Synonyms: | 2-[carbamoyl-[(5-nitrofuran-2-yl)methylideneamino]amino]acetic acid;Acetic acid,2-[1-(aminocarbonyl)-2-[(5-nitro-2-furanyl)methylene]hydrazinyl]-;3-(5-nitrofurfurylideneamino)hydantoic acid;2-[1-Carbamoyl-2-(5-nitrofurfurylidene)hydrazino]acetic acid;Nitrofurantoin Related Compound A (20 mg) (N-(Aminocarbonyl)-N-[([5-nitro-2-furanyl]-methylene)-amino]-glycine);Nitrofurantoin related coMpound A;Nitrofurantoin USP RC A;2-(1-Carbamoyl-2-((5-nitrofuran-2-yl)methylene)hydrazinyl)acetic acid | | CAS: | 63981-22-6 | | MF: | C8H8N4O6 | | MW: | 256.17 | | EINECS: | | | Product Categories: | Heterocycles, Intermediates, Metabolites & Impurities | | Mol File: | 63981-22-6.mol |  |
| | 3-(5-nitrofurfurylideneamino)hydantoic acid Chemical Properties |
| Melting point | 234 °C (decomp) | | Boiling point | 508.1±60.0 °C(Predicted) | | density | 1.71±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly, Heated), Water (Very Slightly, Heated) | | form | Solid | | pka | 4.02±0.10(Predicted) | | color | Light Yellow to Yellow | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C8H8N4O6/c9-8(15)11(4-7(13)14)10-3-5-1-2-6(18-5)12(16)17/h1-3H,4H2,(H2,9,15)(H,13,14) | | InChIKey | URYZARAFMQWNPZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CN(C(N)=O)N=CC1=CC=C([N+]([O-])=O)O1 |
| WGK Germany | WGK 3 | | HS Code | 2932190002 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-(5-nitrofurfurylideneamino)hydantoic acid Usage And Synthesis |
| Uses | 3-(5-Nitrofurfurylideneamino)hydantoic Acid, is a new derivative of 5-Nitro-2-furfural, and they are proved to be bactericidal. Nitrofurantoin USP Related Compound A. |
| | 3-(5-nitrofurfurylideneamino)hydantoic acid Preparation Products And Raw materials |
|