|
|
| | 4-Morpholinophenylboronic acid Basic information |
| | 4-Morpholinophenylboronic acid Chemical Properties |
| Melting point | 126 °C | | Boiling point | 425.9±55.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | pka | 9.26±0.17(Predicted) | | color | Grey | | InChI | InChI=1S/C10H14BNO3/c13-11(14)9-1-3-10(4-2-9)12-5-7-15-8-6-12/h1-4,13-14H,5-8H2 | | InChIKey | WHDIUBHAKZDSJL-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(N2CCOCC2)C=C1)(O)O | | CAS DataBase Reference | 186498-02-2(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 22-26-36/37/39 | | WGK Germany | WGK 3 | | Hazard Note | Harmful | | HS Code | 2934999090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral |
| | 4-Morpholinophenylboronic acid Usage And Synthesis |
| Uses | 4-Morpholinophenylboronic Acid is a useful research chemical for the preparation of biologically and pharmacologically active molecules. |
| | 4-Morpholinophenylboronic acid Preparation Products And Raw materials |
|