|
|
| | 1-Benzyl-4-cyano-4-phenylpiperidine hydrochloride Basic information |
| | 1-Benzyl-4-cyano-4-phenylpiperidine hydrochloride Chemical Properties |
| Melting point | 257-261 °C | | solubility | DMSO (Sparingly), Methanol (Sparingly) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C19H20N2.ClH/c20-16-19(18-9-5-2-6-10-18)11-13-21(14-12-19)15-17-7-3-1-4-8-17;/h1-10H,11-15H2;1H | | InChIKey | SPXFNRMZPRHYRH-UHFFFAOYSA-N | | SMILES | N1(CC2=CC=CC=C2)CCC(C#N)(C2=CC=CC=C2)CC1.[H]Cl | | CAS DataBase Reference | 71258-18-9(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22 | | Safety Statements | 45 | | RIDADR | UN 3439 6.1/PG III | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29333999 |
| Provider | Language |
|
ACROS
| English |
| | 1-Benzyl-4-cyano-4-phenylpiperidine hydrochloride Usage And Synthesis |
| Chemical Properties | White to beige powder | | Uses | A piperidine derivative as calcium channel blockers. |
| | 1-Benzyl-4-cyano-4-phenylpiperidine hydrochloride Preparation Products And Raw materials |
|