|
|
| | 2,2′-Azobis(2-methylpropionamidine) dihydrochloride Basic information |
| Product Name: | 2,2′-Azobis(2-methylpropionamidine) dihydrochloride | | Synonyms: | 2,2’-azobis(2-methyl-propanimidamiddihydrochloride;2,2’-azobis(2-methyl-propionamidindihydrochloride;2,2’-azobis[2-methyl-propanimidamiddihydrochloride;2,2'-AZOBIS(ISOBUTYRAMIDINE) DIHYDROCHLORIDE;2,2'-AZOBIS-(2-AMIDINOPROPANE), 2HCL;2,2'-AZOBIS(2-AMIDINOPROPANE) DIHYDROCHLORIDE;2,2'-AZOBIS-(2-AMIDOPROPANE) HYDROCHLORIDE;ALPHA,ALPHA'-AZODIISOBUTYRAMIDINE DIHYDROCHLORIDE | | CAS: | 2997-92-4 | | MF: | C8H20Cl2N6 | | MW: | 271.19 | | EINECS: | 221-070-0 | | Product Categories: | pharmacetical;2997-92-4 | | Mol File: | 2997-92-4.mol |  |
| | 2,2′-Azobis(2-methylpropionamidine) dihydrochloride Chemical Properties |
| Melting point | 175-177 °C(lit.) | | density | 0.42 | | vapor pressure | 0Pa at 20℃ | | storage temp. | 0-6°C | | solubility | acetone, dioxane, methanol, ethanol, DMSO and water: soluble | | form | granular | | color | White to off-white | | Water Solubility | 176.2g/L at 20℃ | | Stability: | Unstable. Sensitive to heat and light. Incompatible with strong oxidizing agents, strong acids. | | InChI | InChI=1S/C8H18N6.2ClH/c1-7(2,5(9)10)13-14-8(3,4)6(11)12;;/h1-4H3,(H3,9,10)(H3,11,12);2*1H/b14-13+;; | | InChIKey | LXEKPEMOWBOYRF-QDBORUFSSA-N | | SMILES | C(C)(C)(/N=N/C(C)(C)C(=N)N)C(=N)N.Cl.Cl | | LogP | 0.3 at 25℃ | | CAS DataBase Reference | 2997-92-4(CAS DataBase Reference) | | EPA Substance Registry System | Propanimidamide, 2,2'-azobis[2-methyl-, dihydrochloride (2997-92-4) |
| Hazard Codes | Xn | | Risk Statements | 22-43-5 | | Safety Statements | 24-37 | | RIDADR | UN 3226 4.1 | | WGK Germany | 1 | | RTECS | UE4575500 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 5.1 | | PackingGroup | III | | HS Code | 29270000 | | Storage Class | 4.2 - Pyrophoric and self-heating hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Self-heat. 1
Skin Sens. 1 | | Toxicity | LD50 oral in rat: 410mg/kg |
| | 2,2′-Azobis(2-methylpropionamidine) dihydrochloride Usage And Synthesis |
| Chemical Properties | light yellow crystalline powder | | Uses | 2,2'-Azobis(2-methylpropionamidine) dihydrochloride can be used as free radical initiator, apoptosis inducer. | | Uses | 2,2'-Azobis(2-methylpropionamidine) dihydrochloride is used to prepare Resveratrol and its analogues for use as antioxidants. Also acts as an antioxidant. | | Uses | Free radical initiator.
Polymerization initiator for acrylic, vinyl and allyl monomers. | | Definition | ChEBI: AAPH is an azo compound. | | Flammability and Explosibility | Non flammable | | Safety Profile | Poison by ingestion. A skinirritant. When heated to decomposition it emits toxicvapors of NOx and HCl. |
| | 2,2′-Azobis(2-methylpropionamidine) dihydrochloride Preparation Products And Raw materials |
|