| Company Name: |
HBCChem, Inc. |
| Tel: |
+1-510-219-6317 |
| Email: |
sales@hbcchem.com |
1,4-Bis((2,3-epoxypropoxy)methyl)cyclohexane manufacturers
|
| | 1,4-Bis((2,3-epoxypropoxy)methyl)cyclohexane Basic information |
| Product Name: | 1,4-Bis((2,3-epoxypropoxy)methyl)cyclohexane | | Synonyms: | 2,2’-[1,4-cyclohexanediylbis(methyleneoxymethylene)]bis-oxiran;2,2’-[1,4-cyclohexanediylbis(methyleneoxymethylene)]bis-Oxirane;DIGLYCIDYL ETHER OF 1,4-CYCLOHEXANEDIMETHANOL;1,4-CYCLOHEXANEDIMETHANOL DIGLYCIDYL ETH ER, TECH., MIXTURE OF CIS AND TRANS;Oxirane, 2,2-1,4-cyclohexanediylbis(methyleneoxymethylene)bis-;1,4-cyclohexanedimethanol diglycidyl ether, mixture of cis and trans;1,4-Bis[(2,3-epoxypropoxy)methyl]cyclohexan;1,4-CyclohexanediMethanol diglycidyl ether, Mixture of cis and trans technical grade | | CAS: | 14228-73-0 | | MF: | C14H24O4 | | MW: | 256.34 | | EINECS: | 238-098-4 | | Product Categories: | Epoxide Monomers;Monomers;Polymer Science | | Mol File: | 14228-73-0.mol |  |
| | 1,4-Bis((2,3-epoxypropoxy)methyl)cyclohexane Chemical Properties |
| Boiling point | 154-160°C | | density | 1.1 g/mL at 25 °C(lit.) | | vapor density | >1 (vs air) | | vapor pressure | 11.4 mm Hg ( 25 °C) | | refractive index | n20/D 1.481(lit.) | | Fp | >230 °F | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Clear Colourless to Pale Yellow | | Water Solubility | 3.741g/L at 20℃ | | InChI | InChI=1S/C14H24O4/c1-2-12(6-16-8-14-10-18-14)4-3-11(1)5-15-7-13-9-17-13/h11-14H,1-10H2 | | InChIKey | VQMQXWYQIIUJIT-UHFFFAOYSA-N | | SMILES | C1(COCC2CO2)CCC(COCC2CO2)CC1 | | LogP | 2.29 at 30℃ | | EPA Substance Registry System | 1,4-Bis(glycidyloxymethyl)cyclohexane (14228-73-0) |
| Hazard Codes | Xn | | Risk Statements | 43 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Skin Sens. 1 |
| | 1,4-Bis((2,3-epoxypropoxy)methyl)cyclohexane Usage And Synthesis |
| Uses | 1,4-Cyclohexanedimethanol Diglycidyl Ether is used in method for preparing high-strength and high-hardness epoxy modified MS sealant. |
| | 1,4-Bis((2,3-epoxypropoxy)methyl)cyclohexane Preparation Products And Raw materials |
|