|
|
| | BIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)ZINC Basic information |
| Product Name: | BIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)ZINC | | Synonyms: | Nsc174890;Zinc di(pivaloylmethane);2,2,6,6-Tetramethyl-3,5-heptanedione zinc derivative, Zn(TMHD)2;Bis(2,2,6,6-tetramethyl-3,5-heptanedionato)zinc (II), 99% (Zn(TMHD)2);Zinc(II) 2,2,6,6-Tetramethyl-3,5-Heptanedionate 99.9%;Bis(2,2,6,6-tetraMethyl-3,5-heptanedionato)zinc,98% Zn(TMHD)2;Bis(2,2,6,6-tetraMethyl-3,5-heptanedionate)zinc 99%;Zinc tetramethylheptanedionato | | CAS: | 14363-14-5 | | MF: | C22H38O4Zn | | MW: | 431.92 | | EINECS: | | | Product Categories: | Other Metal;metal beta-diketonate complexes | | Mol File: | 14363-14-5.mol |  |
| | BIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)ZINC Chemical Properties |
| Melting point | 132-134 °C(lit.) | | Boiling point | 250°C | | Fp | 250°C | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | crystal | | color | white | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/2C11H20O2.Zn/c2*1-10(2,3)8(12)7-9(13)11(4,5)6;/h2*7,12H,1-6H3;/q;;+2/p-2/b2*8-7+; | | InChIKey | QWDQAWFEDOIHGD-ORWWTJHYSA-L | | SMILES | CC(C)(C)C(=O)\C=C(\O[Zn]O\C(=C\C(=O)C(C)(C)C)C(C)(C)C)C(C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | No | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | BIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)ZINC Usage And Synthesis |
| reaction suitability | reagent type: catalyst |
| | BIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)ZINC Preparation Products And Raw materials |
|