- 5-DEMETHYLNOBILETIN
-
-
2026-06-30
- CAS:2174-59-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000kg
|
| | 5-DEMETHYLNOBILETIN Basic information |
| Product Name: | 5-DEMETHYLNOBILETIN | | Synonyms: | 5-DEMETHYLNOBILETIN;5-DIMETHYLNOBILETIN;2-(3,4-Dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-chromen-4-one;2-(3,4-dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxychromen-4-one;4H-1-Benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-;5-O-Demethylnobiletin (Standard);5-Demethylnobiletin-RM | | CAS: | 2174-59-6 | | MF: | C20H20O8 | | MW: | 388.37 | | EINECS: | | | Product Categories: | | | Mol File: | 2174-59-6.mol |  |
| | 5-DEMETHYLNOBILETIN Chemical Properties |
| Melting point | 145-146℃ | | Boiling point | 601.4±55.0 °C(Predicted) | | density | 1.304±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | solubility | Soluble in methan | | form | powder | | pka | 6.81±0.40(Predicted) | | color | Yellow | | Major Application | food and beverages | | InChI | InChI=1S/C20H20O8/c1-23-12-7-6-10(8-14(12)24-2)13-9-11(21)15-16(22)18(25-3)20(27-5)19(26-4)17(15)28-13/h6-9,22H,1-5H3 | | InChIKey | DOFJNFPSMUCECH-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(OC)C(OC)=C2)OC2=C(OC)C(OC)=C(OC)C(O)=C2C(=O)C=1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5-DEMETHYLNOBILETIN Usage And Synthesis |
| Uses | 2-(3,4-Dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-chromen-4-one is used in the treatment of neurodegenerative and metabolic disorders | | Definition | ChEBI: Demethylnobiletin is an ether and a member of flavonoids. | | target | COX | LOX |
| | 5-DEMETHYLNOBILETIN Preparation Products And Raw materials |
|