|
|
| | ERIODICTIOL-7-GLUCOSIDE Basic information |
| Product Name: | ERIODICTIOL-7-GLUCOSIDE | | Synonyms: | hesperetin 7-O-beta-D-glucoside;ERIODICTIOL-7-GLUCOSIDE;4H-1-Benzopyran-4-one, 7-(beta-D-glucopyranosyloxy)-2,3-dihydro-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-, (S)-;Hesperetin 7-O-glucoside;Hesperitin-7-O-β-D-glucoside;4H-1-Benzopyran-4-one,7-(b-D-glucopyranosyloxy)-2,3-dihydro-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-,(2S)-;4H-1-Benzopyran-4-one, 7-(β-D-glucopyranosyloxy)-2,3-dihydro-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-, (2S)-;hesperetin7-O-β-D-glucoside | | CAS: | 31712-49-9 | | MF: | C22H24O11 | | MW: | 464.42 | | EINECS: | | | Product Categories: | | | Mol File: | 31712-49-9.mol |  |
| | ERIODICTIOL-7-GLUCOSIDE Chemical Properties |
| Melting point | 206-207 °C | | Boiling point | 807.1±65.0 °C(Predicted) | | density | 1.569±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 7.16±0.40(Predicted) | | form | Powder | | color | White to off-white | | InChIKey | ADSYMQORONDIDD-QENDSQSDNA-N | | SMILES | O=C1C[C@@H](C2C=CC(OC)=C(O)C=2)OC2=CC(O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O3)O)=CC(O)=C12 |&1:3,18,19,20,22,24,r| |
| | ERIODICTIOL-7-GLUCOSIDE Usage And Synthesis |
| Uses | Hesperetin 7-O-glucoside can be used to treat osteoporosis, scavenging free radicals, varicose veins, reducing blood lipid and decreasing blood pressure. It can also be used to promote plant growth and treat plant anti-bacterial infections. | | Definition | ChEBI: A flavanone 7-O-beta-D-glucoside having hesperetin as the flavanone component. | | in vivo | Hesperetin 7-O-glucoside (1 mg/kg; Oral administration; 7 days) had anti-inflammatory and protective effects in a mouse model of dextran sodium sulfate(HY-116282C) induced colitis[2].
Hesperetin 7-O-glucoside (1-10 mg/kg; Oral gavage; 7 days) regulates intestinal flora and metabolic homeostasis in mice[3]. | Animal Model: | Dextran sodium sulfate (DSS) (HY-116282C) treated female C57BL/6N mice aged six weeks old (16-18 g)[2] | | Dosage: | 1 mg/kg | | Administration: | Oral administration (p.o.); 7 days | | Result: | Markedly alleviated the inflammatory status in DSS-induced colitis mice, manifested by the recovered colon length from 5.91± 0.66 to 6.45 ± 0.17 cm, histopathological changes, and mRNA levels of colonic inflammatory factors including TNF-α and IL-22.
Regulated the gut microbiota composition in the cecal contents and co-metabolites.
|
| Animal Model: | Female C57BL/6N mice aged six weeks old (16-18 g)[3] | | Dosage: | 1, 5 and 10 mg/kg | | Administration: | Oral gavage (i.g.); 7 days | | Result: | Regulated fecal microbiota and its derived metabolites, including short-chain fatty acids (SCFAs) and tryptophan metabolites (indole and its derivatives), in feces of mice.
Significantly changed urinary hippurate and trimethylamine Noxide (TMAO), co-metabolites of the microbe and host.
Modulated the host tricarboxylic acid cycle (TCA) involved in energy metabolism. |
| | target | HMG-CoA Reductase | Antifection | | IC 50 | IL-1β; IL-22 |
| | ERIODICTIOL-7-GLUCOSIDE Preparation Products And Raw materials |
|