|
|
| | 4-Iodophenylacetate Basic information |
| Product Name: | 4-Iodophenylacetate | | Synonyms: | 1-Iodo-4-acetoxybenzene;Acetic acid 4-iodophenyl ester;4-iodo-Phenol, acetate;Phenol, 4-iodo-, 1-acetate;Chlorimuron Impurity 8;4-Iodophenyl acetate - [K88149];phenol,4-iodo-,acetate;1-Acetoxy-4-iodobenzene | | CAS: | 33527-94-5 | | MF: | C8H7IO2 | | MW: | 262.04 | | EINECS: | | | Product Categories: | | | Mol File: | 33527-94-5.mol |  |
| | 4-Iodophenylacetate Chemical Properties |
| Melting point | 38 °C | | Boiling point | 271.0±23.0 °C(Predicted) | | density | 1.757±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H7IO2/c1-6(10)11-8-4-2-7(9)3-5-8/h2-5H,1H3 | | InChIKey | MXHYFISNECFQHA-UHFFFAOYSA-N | | SMILES | C1(OC(=O)C)=CC=C(I)C=C1 |
| | 4-Iodophenylacetate Usage And Synthesis |
| | 4-Iodophenylacetate Preparation Products And Raw materials |
|