|
|
| | (S)-3-AMINO-3-(4-CHLORO-PHENYL)-PROPIONIC ACID Basic information |
| | (S)-3-AMINO-3-(4-CHLORO-PHENYL)-PROPIONIC ACID Chemical Properties |
| Boiling point | 345.8±32.0 °C(Predicted) | | density | 1.333 | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.62±0.10(Predicted) | | Appearance | Off-white to gray Solid | | Optical Rotation | 6.4°(C=1.00g/100ml H2O) | | InChI | InChI=1/C9H10ClNO2/c10-7-3-1-6(2-4-7)8(11)5-9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/s3 | | InChIKey | BXGDBHAMTMMNTO-SBYBRXNCNA-N | | SMILES | [C@H](C1C=CC(Cl)=CC=1)(N)CC(=O)O |&1:0,r| | | CAS DataBase Reference | 131690-60-3(CAS DataBase Reference) |
| | (S)-3-AMINO-3-(4-CHLORO-PHENYL)-PROPIONIC ACID Usage And Synthesis |
| Uses | (S)-3-Amino-3-(4-chlorophenyl)-propionic acid is an important chiral amino acid derivative, widely used in drug development and synthesis of bioactive compounds. |
| | (S)-3-AMINO-3-(4-CHLORO-PHENYL)-PROPIONIC ACID Preparation Products And Raw materials |
|