- Carabrone
-
- $9.80 / 1KG
-
2020-01-13
- CAS:1748-81-8
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20 tons
|
| | Carabrone Basic information |
| Product Name: | Carabrone | | Synonyms: | (3aR,4aα,6aα)-Octahydro-5aα-methyl-3-methylene-5α-(3-oxobutyl)-2H-cyclopropa[f]benzofuran-2-one;(3aR,4aS,5S,5aR,6aR)-5-(3-ketobutyl)-5a-methyl-3-methylene-3a,4,4a,5,6,6a-hexahydrocyclopropa[f]benzofuran-2-one;(3aR,4aS,5S,5aR,6aR)-5a-methyl-3-methylidene-5-(3-oxobutyl)-3a,4,4a,5,6,6a-hexahydrocyclopropa[f][1]benzofuran-2-one;Carabron;Grandicin;Carabrone;Octahydro-5a-methyl-3-methylene-5-(3-oxobutyl)-2H-cyclopropa[f]benzofuran-2-one;2H-Cyclopropa[f]benzofuran-2-one, octahydro-5a-methyl-3-methylene-5-(3-oxobutyl)-, (3aR,4aS,5S,5aR,6aR)- | | CAS: | 1748-81-8 | | MF: | C15H20O3 | | MW: | 248.32 | | EINECS: | | | Product Categories: | Sesquiterpenoids | | Mol File: | 1748-81-8.mol |  |
| | Carabrone Chemical Properties |
| storage temp. | Store at -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Cryst. | | color | White to off-white | | InChI | InChI=1S/C15H20O3/c1-8(16)4-5-11-12-6-10-9(2)14(17)18-13(10)7-15(11,12)3/h10-13H,2,4-7H2,1,3H3/t10-,11+,12+,13-,15-/m1/s1 | | InChIKey | AGIQIKMGJVLKMA-NLRWUALESA-N | | SMILES | O1[C@]2([H])C[C@]3(C)[C@@H](CCC(=O)C)[C@]3([H])C[C@]2([H])C(=C)C1=O |
| | Carabrone Usage And Synthesis |
| Uses | Carabron is a botanical bicyclic sesquiterpenic lactone with broad-spectrum antifungal activity against the devastating phytopathogen Gaeumannomyces graminis var. tritici. A potential antifungal agent. | | target | Antifection |
| | Carabrone Preparation Products And Raw materials |
|