|
|
| | trans,trans-4-Methoxy-4'-n-propyl-1,1'-bicyclohexyl Basic information |
| Product Name: | trans,trans-4-Methoxy-4'-n-propyl-1,1'-bicyclohexyl | | Synonyms: | trans,trans-4-Methoxy-4'-n-propyl-1,1'-bicyclohexyl;TRANS,TRANS-4-PROPYL-4''-METHOXY-BICYCLOHEXYL;4-Methoxy-4'-propyl-1,1'-bicyclohexane;(Trans,trans)-4-methoxy-4'-propyl-1,1'-bi(cyclohexane);trans-1-methoxy-4-(trans-4-propylcyclohexyl)cyclohexane;4'-Methoxy-4-propyl-1,1'-bicyclohexyl;1,1'-Bicyclohexyl, 4-methoxy-4'-propyl-,(tranS,tranS)-;trans,trans-4-Methoxy-4'-propyl-1,1'-bicyclohexyl | | CAS: | 97398-80-6 | | MF: | C16H30O | | MW: | 238.41 | | EINECS: | 619-269-6 | | Product Categories: | | | Mol File: | 97398-80-6.mol |  |
| | trans,trans-4-Methoxy-4'-n-propyl-1,1'-bicyclohexyl Chemical Properties |
| Melting point | 10 °C | | Boiling point | 294.8±8.0 °C(Predicted) | | density | 0.90±0.1 g/cm3(Predicted) | | vapor pressure | 0.037Pa at 25℃ | | refractive index | 1.48 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Colourless Semi-Solid | | color | Colorless to Almost colorless | | Water Solubility | 20μg/L at 20℃ | | InChI | InChI=1S/C16H30O/c1-3-4-13-5-7-14(8-6-13)15-9-11-16(17-2)12-10-15/h13-16H,3-12H2,1-2H3/t13-,14-,15-,16- | | InChIKey | JMOYCPSDEMHCFG-BIAGXBKMSA-N | | SMILES | [C@@H]1([C@@H]2CC[C@@H](CCC)CC2)CC[C@@H](OC)CC1 | | LogP | 4.6 at 24℃ |
| | trans,trans-4-Methoxy-4'-n-propyl-1,1'-bicyclohexyl Usage And Synthesis |
| Flammability and Explosibility | Not classified |
| | trans,trans-4-Methoxy-4'-n-propyl-1,1'-bicyclohexyl Preparation Products And Raw materials |
|