| Company Name: |
Capot Chemical Co.,Ltd. |
| Tel: |
+86-（0）57185586718; +8613336195806 |
| Email: |
sales@capot.com |
| Products Intro: |
Product Name:4,4,5,5-Tetramethyl-2-(thiophen-2-yl)-1,3,2-dioxaborolane
CAS:193978-23-3
Purity:98%(Min,HPLC) Package:100g;1kg;5kg,10kg,25kg,50kg
|
|
|
|
|
|
| | Thiophene-2-boronic acid pinacol ester Basic information |
| Product Name: | Thiophene-2-boronic acid pinacol ester | | Synonyms: | THIOPHENE-2-BORONIC ACID, PINACOL ESTER;2-THIOPHENEBORONIC ACID PINACOL ESTER;2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIOPHENE;4,4,5,5-Tetramethyl-2-(thien-2-yl)-1,3,2-dioxaborolane;4,4,5,5-tetramethyl-2-(thiophen-2-yl)-1,3,2-dioxaborolane;4,4,5,5-TetraMethyl-2-(2-thienyl)-1,3,2-dioxaborolane;Thiophene-2-boronic acid pinacol ester
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene;2-(thiophene-2-yl)-4,4,5,5-tetraMethyl-[1,3,2]dioxaborolane | | CAS: | 193978-23-3 | | MF: | C10H15BO2S | | MW: | 210.1 | | EINECS: | | | Product Categories: | Boronic acids;Boron, Nitrile, Thio,& TM-Cpds;Heterocycles;Materials Science;New Products for Materials Research and Engineering;Organic and Printed Electronics;Synthetic Intermediates;Synthetic Tools and Reagents;Thiophene Monomers and Building Blocks | | Mol File: | 193978-23-3.mol |  |
| | Thiophene-2-boronic acid pinacol ester Chemical Properties |
| Melting point | 68-70°C | | Boiling point | 286.5±13.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | soluble in Methanol | | form | Solid | | color | White to Almost white | | λmax | 239 nm at 0.01 g/L in methanol | | InChI | InChI=1S/C10H15BO2S/c1-9(2)10(3,4)13-11(12-9)8-6-5-7-14-8/h5-7H,1-4H3 | | InChIKey | FFZHICFAHSDFKZ-UHFFFAOYSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1C1SC=CC=1 | | CAS DataBase Reference | 193978-23-3(CAS DataBase Reference) |
| | Thiophene-2-boronic acid pinacol ester Usage And Synthesis |
| Uses | Thiophene-2-boronic Acid Pinacol Ester acts as a reagent in the synthesis of bis-amide derivatives as CSF1R inhibitors. |
| | Thiophene-2-boronic acid pinacol ester Preparation Products And Raw materials |
|