|
|
| | 2-Fluoro-4-biphenylylboronic acid Basic information |
| | 2-Fluoro-4-biphenylylboronic acid Chemical Properties |
| Melting point | 243-248 °C (lit.) | | Boiling point | 377.3±52.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 7.52±0.10(Predicted) | | color | White to Almost white | | InChI | 1S/C12H10BFO2/c14-12-8-10(13(15)16)6-7-11(12)9-4-2-1-3-5-9/h1-8,15-16H | | InChIKey | BWYWXDFYJSIUBE-UHFFFAOYSA-N | | SMILES | OB(O)c1ccc(c(F)c1)-c2ccccc2 | | CAS DataBase Reference | 178305-99-2(CAS DataBase Reference) |
| | 2-Fluoro-4-biphenylylboronic acid Usage And Synthesis |
| Uses | suzuki reaction | | Uses | 2-Fluorobiphenyl-4-ylboronic acid |
| | 2-Fluoro-4-biphenylylboronic acid Preparation Products And Raw materials |
|