|
|
| | 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate Basic information |
| | 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate Chemical Properties |
| Melting point | 165-168 °C (lit.) | | Boiling point | 429.5±40.0 °C(Predicted) | | density | 1+-.0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Sparingly), Ethyl Acetate (Slightly), Methanol | | form | Powder | | color | Pale Yellow to Dark Yellow | | BRN | 270885 | | Stability: | Moisture, Temperature, Light sensitive | | InChI | InChI=1S/C12H9BrClNO3/c1-6(16)15-5-10(18-7(2)17)11-9(15)4-3-8(13)12(11)14/h3-5H,1-2H3 | | InChIKey | DSHQTSIXXYZXGR-UHFFFAOYSA-N | | SMILES | C(=O)(N1C2=C(C(Cl)=C(Br)C=C2)C(OC(C)=O)=C1)C | | CAS DataBase Reference | 3030-06-6(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | RIDADR | UN 2811 | | WGK Germany | 3 | | F | 8-10 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate Usage And Synthesis |
| Chemical Properties | Brown Powder | | Uses | 5-Bromo-4-chloroindoxyl 1,3-diacetate was used as starting reagent in the synthesis of 5,5′-dibromo-4,4′-dichloroindigo. |
| | 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate Preparation Products And Raw materials |
|