4-IODOSTYRENE manufacturers
- 4-Iodostyrene
-
- $0.00 / 1kg
-
2025-06-04
- CAS:2351-50-0
- Min. Order: 1kg
- Purity: 98%+
- Supply Ability: 100000kg per Month
|
| | 4-IODOSTYRENE Basic information |
| Product Name: | 4-IODOSTYRENE | | Synonyms: | 4-IODOSTYRENE);Benzene, 1-ethenyl-4-iodo-;1-Ethenyl-4-iodobenzene, 1-Iodo-4-vinylbenzene;KWHSBYQFELZKKS-UHFFFAOYSA-N;1-Ethenyl-4-iodobenzene;DK686;DKFELEX0173;4-Iodostyrene,98% (stabilized with TBC) | | CAS: | 2351-50-0 | | MF: | C8H7I | | MW: | 230.05 | | EINECS: | | | Product Categories: | | | Mol File: | 2351-50-0.mol |  |
| | 4-IODOSTYRENE Chemical Properties |
| Melting point | 44-44.5 °C | | Boiling point | 91-93 °C(Press: 6 Torr) | | density | 1.673±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | crystalline solid | | color | Off-white | | InChI | InChI=1S/C8H7I/c1-2-7-3-5-8(9)6-4-7/h2-6H,1H2 | | InChIKey | KWHSBYQFELZKKS-UHFFFAOYSA-N | | SMILES | C1(C=C)=CC=C(I)C=C1 |
| | 4-IODOSTYRENE Usage And Synthesis |
| Synthesis | General procedure for the synthesis of p-dienylbenzene and 4-iodostyrene from tetravinylsilane and 1,4-diiodobenzene: 1,4-diiodobenzene (0.25 mmol), tetravinylsilane (0.15 mmol), potassium fluoride (1.2 mmol), and loaded palladium nanoparticle catalysts (Pd to substrate molar ratio of 1%) were suspended in N,N-dimethylformamide (1 mL). Subsequently, the reaction flask was evacuated and replaced with argon, and this evacuation-argon replacement cycle was repeated three times (operating pressure of 2 bar). The reaction mixture was stirred at 130°C for 3 h, during which the reaction progress was monitored by gas chromatography (GC) and gas chromatography-mass spectrometry (GC-MS). During this process, all the initial intermediates 3i'-j' formed by single iodide substitution were further reacted to maximize the yield of the target products 3i-j. | | References | [1] Journal of Catalysis, 2013, vol. 302, p. 49 - 57 |
| | 4-IODOSTYRENE Preparation Products And Raw materials |
|