|
|
| | (2-Methyl-5-nitrophenyl)guanidine nitrate Basic information |
| | (2-Methyl-5-nitrophenyl)guanidine nitrate Chemical Properties |
| Melting point | 218-219 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Water | | form | Solid | | color | Off-White | | InChI | InChI=1S/C8H10N4O2.NO3/c1-5-2-3-6(12(13)14)4-7(5)11-8(9)10;2-1(3)4/h2-4H,1H3,(H4,9,10,11);/q;-1 | | InChIKey | UFCUZYAQWJABII-UHFFFAOYSA-N | | SMILES | [N+](=O)([O-])C1=CC(NC(=N)N)=C(C=C1)C.[N+]([O-])([O-])=O |
| | (2-Methyl-5-nitrophenyl)guanidine nitrate Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | (2-Methyl-5-nitrophenyl)guanidine nitrate can be used in therapeutic for benign prostatic hyperplasia | | Uses | (2-Methyl-5-nitrophenyl)guanidine nitrate can be used for the preparation of N-(pyridylpyrimidinylaminophenyl) amides as protein kinase inhibitors. |
| | (2-Methyl-5-nitrophenyl)guanidine nitrate Preparation Products And Raw materials |
|