|
|
| | 4-Methyl-2-pentanamine hydrochloride Basic information | | Physical Form |
| Product Name: | 4-Methyl-2-pentanamine hydrochloride | | Synonyms: | 1,3-Dimethylbutylamine hydrochloride;4-METHYL-2-PENTANAMINE HYDROCHLORIDE;4-Methylpentan-2-amine hydrochloride;1.3-Dimethylbutylamine HCL;4-Methyl-2-pentanamine HCL;4-Methyl-2-pentanamine hydrochloride (1.3-Dimethylbutylamine HCL);4-Methyl-2-pentanamine hydrochloride(1,3-DMBA);DMBA-HCL | | CAS: | 71776-70-0 | | MF: | C6H16ClN | | MW: | 137.65 | | EINECS: | 611-771-3 | | Product Categories: | | | Mol File: | 71776-70-0.mol |  |
| | 4-Methyl-2-pentanamine hydrochloride Chemical Properties |
| Melting point | 139.5 °C | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C6H15N.ClH/c1-5(2)4-6(3)7;/h5-6H,4,7H2,1-3H3;1H | | InChIKey | HJOGOCSHKIAAIB-UHFFFAOYSA-N | | SMILES | CC(N)CC(C)C.[H]Cl |
| | 4-Methyl-2-pentanamine hydrochloride Usage And Synthesis |
| Physical Form | White to yellow powder or crystals | | Uses | 1,3-Dimethylbutylamine Hydrochloride is the hydrochloride salt of 1,3-Dimethylbutylamine (D471475); a reagent used to study the application of unfunctionized polymethacrylate resin as a stationary phase in liquid chromatography with UV detection. | | storage | 4-Methyl-2-pentanamine hydrochloride can store at cool dry place. |
| | 4-Methyl-2-pentanamine hydrochloride Preparation Products And Raw materials |
|