6-Chloro-2-methoxy-3-nitropyridine manufacturers
|
| | 6-Chloro-2-methoxy-3-nitropyridine Basic information |
| Product Name: | 6-Chloro-2-methoxy-3-nitropyridine | | Synonyms: | 2-Chloro-6-methoxy-5-nitropyridine;6-Chloro-2-methoxy-3-nitropyridine;6-Chloro-3-nitro-2-methoxypyridine;2-Methoxy-3-nitro-6-chloropyridine;Pyridine,6-chloro-2-methoxy-3-nitro-;6-Chloro-2-methoxy-3-nitropyridine≥ 98.0 % (GC);6-Chloro-2-methoxy-3-nitropyridine 95%;6-Chloro-2-methoxy-3-nitropyridine ISO 9001:2015 REACH | | CAS: | 40851-91-0 | | MF: | C6H5ClN2O3 | | MW: | 188.57 | | EINECS: | | | Product Categories: | Heterocycle-Pyridine series;Pyridine series | | Mol File: | 40851-91-0.mol |  |
| | 6-Chloro-2-methoxy-3-nitropyridine Chemical Properties |
| Boiling point | 285 °C | | density | 1.445 | | Fp | 126 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -3.96±0.10(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C6H5ClN2O3/c1-12-6-4(9(10)11)2-3-5(7)8-6/h2-3H,1H3 | | InChIKey | OVVBXVJFGCFEFK-UHFFFAOYSA-N | | SMILES | C1(OC)=NC(Cl)=CC=C1[N+]([O-])=O |
| | 6-Chloro-2-methoxy-3-nitropyridine Usage And Synthesis |
| Chemical Properties | Pale yellow color crystalline solid | | References | [1] Patent: EP1894924, 2008, A1. Location in patent: Page/Page column 30 [2] Journal of Medicinal Chemistry, 2017, vol. 60, # 20, p. 8482 - 8514 [3] Patent: WO2008/101682, 2008, A2. Location in patent: Page/Page column 79 [4] Patent: WO2007/39297, 2007, A1. Location in patent: Page/Page column 32-33 [5] Bioorganic Chemistry, 2018, vol. 81, p. 689 - 699 |
| | 6-Chloro-2-methoxy-3-nitropyridine Preparation Products And Raw materials |
|