|
|
| | 2-BROMO-1-[4-HYDROXY-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE Basic information |
| Product Name: | 2-BROMO-1-[4-HYDROXY-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE | | Synonyms: | 2-BROMO-1-[4-HYDROXY-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE;2-Bromo-4-hydroxy-3-(hydroxymethyl)acetophenone;Ethanone, 2-broMo-1-[4-hydroxy-3-(hydroxyMethyl)phenyl]-;2-broMo-1-(4-hydroxy-3-(hydroxyMethyl)phenyl)ethanone;2-broMo-1-[4-hydroxy-3-(hydroxy;Salbutamol impurity 13/2-Bromo-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone;BNKY006-SX03;2-Bromo-4′-Hydroxy-3′- (hydroxymethyl) | | CAS: | 62932-94-9 | | MF: | C9H9BrO3 | | MW: | 245.07 | | EINECS: | 810-683-4 | | Product Categories: | Intermediate;62932-94-9 | | Mol File: | 62932-94-9.mol | ![2-BROMO-1-[4-HYDROXY-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE Structure](CAS/GIF/62932-94-9.gif) |
| | 2-BROMO-1-[4-HYDROXY-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE Chemical Properties |
| Melting point | 128-131°C | | Boiling point | 349.4±11.0 °C(Predicted) | | density | 1.674±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 7.69±0.20(Predicted) | | color | Pale Orange | | Stability: | Not Stable in Solution | | InChI | InChI=1S/C9H9BrO3/c10-4-9(13)6-1-2-8(12)7(3-6)5-11/h1-3,11-12H,4-5H2 | | InChIKey | XWRBIXFTHXFQKC-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(O)C(CO)=C1)CBr |
| | 2-BROMO-1-[4-HYDROXY-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE Usage And Synthesis |
| Uses | 2-Bromo-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone is a reagent used in the design of haptens for the screening of highly sensitive and specific monoclonial antibody to salbatamol. | | Preparation | Obtained by treatment of its diacetate with 1 N hydrogen bromide in tetrahydrofuran at 75°. |
| | 2-BROMO-1-[4-HYDROXY-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE Preparation Products And Raw materials |
|