| Company Name: |
Qingdao Judian'er Technology Co., Ltd Gold
|
| Tel: |
15964234177 |
| Email: |
jiangcaixia@tsingtaofocus.com |
| Products Intro: |
Product Name:5'-Biotin-Amidite
CAS:135137-87-0
Purity:95% HPLC Package:100mg;250mg;根据需求
|
|
| | BIOTIN AMIDITE Basic information |
| Product Name: | BIOTIN AMIDITE | | Synonyms: | PhosphoraMidous acid, bis(1-Methylethyl)-, 6-[[5-[(3aS,4S,6aR)-1-[bis(4-Methoxyphenyl)phenylMethyl]hexahydro-2- oxo-1H-thieno[3,4-d]iMidazol-4-yl]-1-oxopentyl]aMino]hexyl 2-cyanoethyl ester;[1-N-(4,4a€-Dimethoxytrityl)biotinyl-6-aminohexyl]-2-(cyanoethyl-N,N-diisopropyl)phosphoramidite;Phosphoramidous acid, N,N-bis(1-methylethyl)-, 6-[[5-[(3aS,4S,6aR)-1-[bis(4-methoxyphenyl)phenylmethyl]hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-1-oxopentyl]amino]hexyl 2-cyanoethyl ester;DMT-BIOTIN- PHOSPHORAMIDITE;5'-Biotin CE Phosphoramidite;S-(2-(3-((2R,3R,4R,5R)-5-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-3-((tert-butyldimethylsilyl)oxy)-4-(((2-cyanoethoxy)(diisopropylamino)phosphanyl)oxy)tetrahydrofuran-2-yl)-2,6-dioxo-3,6-dihydropyrimidin-1(2H)-yl)ethyl) benzothioate | | CAS: | 135137-87-0 | | MF: | C46H64N5O6PS | | MW: | 846.07 | | EINECS: | | | Product Categories: | Amidite | | Mol File: | 135137-87-0.mol |  |
| | BIOTIN AMIDITE Chemical Properties |
| Boiling point | 934.9±65.0 °C(Predicted) | | storage temp. | -20°C | | pka | 13.16±0.40(Predicted) | | InChIKey | RBXYKQBFPLXSJS-JTZZDMMCNA-N | | SMILES | P(N(C(C)C)C(C)C)(OCCCCCCNC(=O)CCCC[C@H]1[C@@]2([H])NC(=O)N(C(C3=CC=C(OC)C=C3)(C3=CC=C(OC)C=C3)C3=CC=CC=C3)[C@@]2([H])CS1)OCCC#N |&1:22,23,52,r| |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | BIOTIN AMIDITE Usage And Synthesis |
| Uses | Reagent used in the preparation of Biotinylated oligonucleotides. |
| | BIOTIN AMIDITE Preparation Products And Raw materials |
|