- Kumatakenin
-
- $44.00 / 1mg
-
2026-02-02
- CAS:3301-49-3
- Min. Order:
- Purity: 98.41%
- Supply Ability: 10g
|
| | Kumatakenin Basic information |
| Product Name: | Kumatakenin | | Synonyms: | 3,7-Di-O-methylkaempferol;Jaranol;Kaempferol 3,7-dimethyl ether;Kaempferol-3,7-dimethyl ether;4H-1-Benzopyran-4-one,5-hydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxy-;5-hydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxychromen-4-one;5-Hydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one;ovarian,Inhibitor,cell,Apoptosis,inhibit,Kumatakenin,cancer | | CAS: | 3301-49-3 | | MF: | C17H14O6 | | MW: | 314.29 | | EINECS: | | | Product Categories: | Flavanols | | Mol File: | 3301-49-3.mol |  |
| | Kumatakenin Chemical Properties |
| Melting point | 253-254 °C | | Boiling point | 578.4±50.0 °C(Predicted) | | density | 1.46±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder | | pka | 6.18±0.40(Predicted) | | color | Yellow | | InChI | InChI=1S/C17H14O6/c1-21-11-7-12(19)14-13(8-11)23-16(17(22-2)15(14)20)9-3-5-10(18)6-4-9/h3-8,18-19H,1-2H3 | | InChIKey | BJBUTJQYZDYRMJ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(O)C=C2)OC2=CC(OC)=CC(O)=C2C(=O)C=1OC |
| | Kumatakenin Usage And Synthesis |
| Uses | 5-Hydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one is a Antimicrobial flavonoids from Psiadia trinervia. | | Definition | ChEBI: Kaempferol 3,7-dimethyl ether is a member of flavonoids and an ether. |
| | Kumatakenin Preparation Products And Raw materials |
|