- Dibromoethane-d4
-
- $0.00 / 1mg
-
2026-01-04
- CAS:22581-63-1
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | DibroMoethane-d4 Basic information |
| Product Name: | DibroMoethane-d4 | | Synonyms: | 1,2-Dibromoethane-d, 99%(Isotopic);1,2-Dibromoethane-d4, 99%(Isotopic);Einecs 245-102-8;1,2-Dibromoethane-D4 99.0 Atom % D;1,2-DIBROMOETHANE-D4, 99% (ISOTOPIC);1,2-Dibromoethane-D4(D, 98%);Ethane-1,1,2,2-d4,1,2-dibromo- (8CI,9CI);1,1,2,2-Tetradeutero-1,2-dibromoethane | | CAS: | 22581-63-1 | | MF: | C2Br2D4 | | MW: | 191.89 | | EINECS: | 245-102-8 | | Product Categories: | High Throughput NMR;Insecticides;Labeled;Labware;Metabolites;NMR;NMR Solvents;NMR Solvents and Reagents;Pesticides;Pesticides &;Routine NMR;Solvent by Application;Solvents;Solvents for High Throughput NMR;Spectroscopy Solvents (IR;Stable Isotopes;Tubes and Accessories;UV/Vis);Additional NMR Solvents;Aldrich High Purity NMR Solvents for Routine NMR;Alphabetical Listings;Analytical Standards;Analytical/Chromatography;Chromatography;D;Environmental Standards;Fumigants | | Mol File: | 22581-63-1.mol |  |
| | DibroMoethane-d4 Chemical Properties |
| Melting point | 9°C | | Boiling point | 131-132 °C(lit.) | | density | 2.226 g/mL at 25 °C | | refractive index | n20/D 1.536(lit.) | | Fp | 132°C | | storage temp. | Refrigerator | | solubility | Acetonitrile, Chloroform | | form | Liquid | | color | Colourless to Yellow | | Water Solubility | Insoluble in water. Soluble in chloroform. | | Stability: | Volatile | | Major Application | agriculture
environmental
pharmaceutical | | InChI | InChI=1S/C2H4Br2/c3-1-2-4/h1-2H2/i1D2,2D2 | | InChIKey | PAAZPARNPHGIKF-LNLMKGTHSA-N | | SMILES | C([2H])([2H])(Br)C([2H])([2H])Br | | CAS Number Unlabeled | 106-93-4 |
| Hazard Codes | T | | Risk Statements | 45-23/24/25-36/37/38-51/53 | | Safety Statements | 53-45 | | RIDADR | UN 1605 6.1/PG 1 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | I | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Chronic 2
Carc. 1B
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | DibroMoethane-d4 Usage And Synthesis |
| Chemical Properties | Clear Colourless Oil | | Uses | As labelled Dibromoethane, a short-chain haloalkane isotope, DibroMoethane-d4 can be used to hepatotoxicity and hepatic DNA damage of 1,2-dibromoethane. Dibromoethane was shown to cause DNA single-strand breaks in isolated rat h epatocytes. | | Uses | It is employed as a mutagenesis research chemical. Dibromoethane was shown to cause DNA single-strand breaks in isolated rat hepatocytes. |
| | DibroMoethane-d4 Preparation Products And Raw materials |
|