|
|
| | 7-OXIDE-7-AZAINDOLE Basic information |
| | 7-OXIDE-7-AZAINDOLE Chemical Properties |
| Melting point | 126-1280C | | Boiling point | 352.7±34.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform, DMSO, Methanol | | form | Solid | | pka | 12.68±0.40(Predicted) | | color | Beige | | InChI | InChI=1S/C7H6N2O/c10-9-5-1-2-6-3-4-8-7(6)9/h1-5,8H | | InChIKey | ROGGVUMLTXEIDB-UHFFFAOYSA-N | | SMILES | C12NC=CC=1C=CC=[N+]2[O-] |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26 | | RIDADR | UN 2811 6.1/PG 3 | | HS Code | 29339900 |
| | 7-OXIDE-7-AZAINDOLE Usage And Synthesis |
| Chemical Properties | Beige Solid | | Uses | 1H-Pyrrolo[2,3-b]pyridine 7-Oxide (cas# 55052-24-9) is a compound useful in organic synthesis. |
| | 7-OXIDE-7-AZAINDOLE Preparation Products And Raw materials |
|