|
|
| | methyl 2-cyclopropylacetate Basic information |
| Product Name: | methyl 2-cyclopropylacetate | | Synonyms: | methyl 2-cyclopropylacetate;Cyclopropaneacetic acid methyl ester;Cyclopropylacetic acid methyl ester;Methyl cyclopropylacetate;tert-butyl 3-allyl-3-hydroxyazetidine-82-carboxylate | | CAS: | 34108-21-9 | | MF: | C6H10O2 | | MW: | 114.14 | | EINECS: | | | Product Categories: | | | Mol File: | 34108-21-9.mol |  |
| | methyl 2-cyclopropylacetate Chemical Properties |
| Boiling point | 128-132 °C(Press: 748 Torr) | | density | 1.030±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Colourless | | InChI | InChI=1S/C6H10O2/c1-8-6(7)4-5-2-3-5/h5H,2-4H2,1H3 | | InChIKey | CRBILHZMYDIQRQ-UHFFFAOYSA-N | | SMILES | C1(CC(OC)=O)CC1 |
| | methyl 2-cyclopropylacetate Usage And Synthesis |
| Uses | Methyl 2-Cyclopropylacetate is used in preparation of Heterocyclyldihydropyrazolopyrimidinone derivatives for use as PDE9A modulators. |
| | methyl 2-cyclopropylacetate Preparation Products And Raw materials |
|