|
|
| | 1-BROMO-3-CHLORO-2-FLUOROBENZENE Basic information |
| | 1-BROMO-3-CHLORO-2-FLUOROBENZENE Chemical Properties |
| Melting point | 44 °C | | Boiling point | 197.9±20.0 °C(Predicted) | | density | 1.719±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Solid | | color | White to pale yellow | | InChI | InChI=1S/C6H3BrClF/c7-4-2-1-3-5(8)6(4)9/h1-3H | | InChIKey | DRNWNTAANHEQMK-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC(Cl)=C1F | | CAS DataBase Reference | 144584-65-6(CAS DataBase Reference) |
| | 1-BROMO-3-CHLORO-2-FLUOROBENZENE Usage And Synthesis |
| | 1-BROMO-3-CHLORO-2-FLUOROBENZENE Preparation Products And Raw materials |
|