|
|
| | 4-(3-ACRYLOYLOXY-N-PROP-1-YLOXY)BENZOIC ACID Basic information |
| | 4-(3-ACRYLOYLOXY-N-PROP-1-YLOXY)BENZOIC ACID Chemical Properties |
| Boiling point | 428.1±25.0 °C(Predicted) | | density | 1.208±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 4.44±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H14O5/c1-2-12(14)18-9-3-8-17-11-6-4-10(5-7-11)13(15)16/h2,4-7H,1,3,8-9H2,(H,15,16) | | InChIKey | AHBWYWGJQFTBRO-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(OCCCOC(=O)C=C)C=C1 |
| | 4-(3-ACRYLOYLOXY-N-PROP-1-YLOXY)BENZOIC ACID Usage And Synthesis |
| Preparation | The preparation of 4-(3-acryloyloxy-n-prop-1-yloxy)benzoic acid is as follows:8.1g Allyl 4- (3- (acryloyloxy) propoxy) benzoic acid,4.1 g of N-methylaniline,Add 0.28 g of palladium acetate and 0.66 g of triphenylphosphine to 50 mL of acetonitrile, andStir at room temperature overnight. The reaction solution is diluted with ethyl acetate,The extract was washed with 5% hydrochloric acid and saturated brine, dried over anhydrous sodium sulfate, the solid was filtered off, and the solvent was evaporated. The residue is purified by column chromatography (silica gel, developing solvent: dichloromethane) to yield 4.2 g of 4- (3- (Acryloyloxy) propoxy) benzoic acid(Yield: 80.0%, purity (HPLC): 93.0%) was obtained. 
|
| | 4-(3-ACRYLOYLOXY-N-PROP-1-YLOXY)BENZOIC ACID Preparation Products And Raw materials |
|