|
|
| | Tetrahydro-5-oxo-2- furancarboxyli Basic information |
| Product Name: | Tetrahydro-5-oxo-2- furancarboxyli | | Synonyms: | Tetrahydro-5-oxo-2- furancarboxyli;2-Furancarboxylic acid, tetrahydro-5-oxo-;Inchi=1/C5H6o4/C6-4-2-1-3(9-4)5(7)8/H3H,1-2H2,(H,7,8;etrahydro-5-oxo-2- furancarboxyli;gamma-Butyrolactone-gamma-carboxylic acid;Tetrahydro-5-oxo-2-furoic acid;alpha-Hydroxyglutaryl lactone;Butyrolactonecarboxylic acid | | CAS: | 4344-84-7 | | MF: | C5H6O4 | | MW: | 130.1 | | EINECS: | | | Product Categories: | Heterocyclic Compounds | | Mol File: | 4344-84-7.mol |  |
| | Tetrahydro-5-oxo-2- furancarboxyli Chemical Properties |
| Melting point | 48-50 °C | | Boiling point | 116-118 °C(Press: 1.5 Torr) | | density | 1.469±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Water (Sparingly) | | pka | 3.11±0.20(Predicted) | | form | Solid | | color | White to Off-White |
| | Tetrahydro-5-oxo-2- furancarboxyli Usage And Synthesis |
| Uses | Carboxybutyrolactone is a structural analog of (±)-Paraconic Acid (P191200) and is used as a reagent in the synthesis of methylenecarboxybutyrolactones which have antibacterial activity. | | Definition | ChEBI: 5-oxotetrahydrofuran-2-carboxylic acid is a gamma-lactone resulting from the formal intramolecular condensation of the alcoholic hydroxy group of 2-hydroxyglutaric acid with the carboxy group at position 5. It is a gamma-lactone and a monocarboxylic acid. |
| | Tetrahydro-5-oxo-2- furancarboxyli Preparation Products And Raw materials |
|