|
|
| | 6-chloro-1H-pyrazolo[3,4-b]pyridine Basic information |
| | 6-chloro-1H-pyrazolo[3,4-b]pyridine Chemical Properties |
| Boiling point | 262℃ | | density | 1.61 | | Fp | 113℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 5.20±0.40(Predicted) | | form | solid | | color | Yellow-brown | | InChI | InChI=1S/C6H4ClN3/c7-5-2-1-4-3-8-10-6(4)9-5/h1-3H,(H,8,9,10) | | InChIKey | NWYLBGYCSAJFCB-UHFFFAOYSA-N | | SMILES | C12NN=CC1=CC=C(Cl)N=2 |
| | 6-chloro-1H-pyrazolo[3,4-b]pyridine Usage And Synthesis |
| Synthesis | GENERAL STEPS: To a solution of tetrahydrofuran (THF, 30 mL) containing 6-chloro-2-fluoropyridine-3-carbaldehyde (4.0 g, 25.1 mmol) was added hydrazine hydrate (2.515 g, 56.3 mmol). The reaction mixture was heated at 60 °C with stirring for 5 hours. Upon completion of the reaction, the mixture was concentrated and quenched with ice water. The solid formed was collected by filtration and dried under vacuum to afford 6-chloro-1hydro-pyrazolo[3,4-B]pyridine (3.5 g, 92% yield). The product was characterized by 1H NMR (DMSO-d6, 300 MHz): δ 13.8 (s, 1H), 8.32-8.29 (d, 1H), 8.20 (s, 1H), 7.27-7.24 (d, 1H). the LCMS analysis showed a purity of 89.96%, m/z = 153.9 (M + 1). | | References | [1] Patent: WO2017/9798, 2017, A1. Location in patent: Page/Page column 66 |
| | 6-chloro-1H-pyrazolo[3,4-b]pyridine Preparation Products And Raw materials |
|