|
|
| | 1,3-Bis(trimethylsilyl)urea Chemical Properties |
| Melting point | 219-221 °C(lit.) | | Boiling point | 222°C | | density | 0.887 | | vapor pressure | 0.002-1850Pa at 25℃ | | Fp | 65°C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | pyridine: soluble100mg/mL, clear to slightly hazy, colorless to light yellow | | pka | 16.51±0.46(Predicted) | | form | solid | | color | White to Almost white | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 1937452 | | InChI | 1S/C7H20N2OSi2/c1-11(2,3)8-7(10)9-12(4,5)6/h1-6H3,(H2,8,9,10) | | InChIKey | MASDFXZJIDNRTR-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)NC(=O)N[Si](C)(C)C | | LogP | -2.11-2.72 at 20℃ | | CAS DataBase Reference | 18297-63-7(CAS DataBase Reference) | | NIST Chemistry Reference | Urea, n,n'-bis(trimethylsilyl)-(18297-63-7) | | EPA Substance Registry System | N,N'-Bis(trimethylsilyl)urea (18297-63-7) |
| Hazard Codes | F,Xn | | Risk Statements | 11-36/37/38-20/21/22 | | Safety Statements | 14-16-24/25-36-26 | | RIDADR | UN 1325 4.1/PG 2 | | WGK Germany | 3 | | F | 3-10-21 | | TSCA | TSCA listed | | HS Code | 29310095 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Flam. Sol. 1 |
| | 1,3-Bis(trimethylsilyl)urea Usage And Synthesis |
| General Description | Silazane is any hydride of silicon and nitrogen having a straight or branched chain of silicon and nitrogen atoms joined by covalent bonds. By extension, the word is also used for any organic derivative of such compounds. They are analogous to siloxanes, with -NH- replacing -O-. Their individual name is dependent on the number of silicon atoms in the chemical structure.
1,3-Bis(trimethylsilyl)urea is an effective silylating agent. It is used in the pharmaceutical and in the chemical industry.
| | Chemical Properties | White solid with mild odor | | Uses | N,N'-Bis(trimethylsilyl)urea is used as a reagent for the silylation of alcohols and carboxylic acids. | | Flammability and Explosibility | Not classified |
| | 1,3-Bis(trimethylsilyl)urea Preparation Products And Raw materials |
|