| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | MNK1/2 Inhibitor II, ETP-45835 Basic information |
| | MNK1/2 Inhibitor II, ETP-45835 Chemical Properties |
| storage temp. | -20°C | | solubility | water: 50 mg/mL | | form | solid | | color | white | | Water Solubility | water: 50mg/mL | | SMILES | C1(C2=CC=NC=C2)=CC(C3CCNCC3)=NN1 |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | MNK1/2 Inhibitor II, ETP-45835 Usage And Synthesis |
| Uses | D-106669 is an inhibitor of Erk2 with an IC50 value of 18.7 μM. D-106669 inhibits cell proliferation with an EC50 value of 0.9 μM[1]. | | References | [1] Irene Seipelt, et al. Pyridopyrazine derivatives and their use. US20070123494A1. |
| | MNK1/2 Inhibitor II, ETP-45835 Preparation Products And Raw materials |
|