|
|
| | 1-[2-Amino-1-(4-methoxyphenyl)-ethyl]-cyclohexanol hydrochloride Basic information |
| | 1-[2-Amino-1-(4-methoxyphenyl)-ethyl]-cyclohexanol hydrochloride Chemical Properties |
| Melting point | 172-180°C | | Boiling point | 394.6℃[at 101 325 Pa] | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Crystalline Powder | | color | White | | Stability: | Hygroscopic | | Major Application | pharmaceutical | | InChI | InChI=1S/C15H23NO2.ClH/c1-18-13-7-5-12(6-8-13)14(11-16)15(17)9-3-2-4-10-15;/h5-8,14,17H,2-4,9-11,16H2,1H3;1H | | InChIKey | NTKXIDDUCSFBBF-UHFFFAOYSA-N | | SMILES | C(CN)(C1C=CC(=CC=1)OC)C1(CCCCC1)O.Cl | | LogP | 2.23 | | CAS DataBase Reference | 130198-05-9(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | HS Code | 2922.50.4000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 3 |
| | 1-[2-Amino-1-(4-methoxyphenyl)-ethyl]-cyclohexanol hydrochloride Usage And Synthesis |
| Uses | 1-[2-Amino-1-(4-methoxyphenyl)ethyl]cyclohexanol Hydrochloride (Venlafaxine EP Impurity C) possesses anti-depressant activity on mice. |
| | 1-[2-Amino-1-(4-methoxyphenyl)-ethyl]-cyclohexanol hydrochloride Preparation Products And Raw materials |
|