1,1',3,3,3',3'-HEXAMETHYLINDOTRICARBOCYANINE IODIDE manufacturers
|
| | 1,1',3,3,3',3'-HEXAMETHYLINDOTRICARBOCYANINE IODIDE Basic information |
| Product Name: | 1,1',3,3,3',3'-HEXAMETHYLINDOTRICARBOCYANINE IODIDE | | Synonyms: | 3,3-trimethyl-rienyl]-iodide;2-[7-(1,3-DIHYDRO-1,3,3-TRIMETHYL-2H-INDOL-2-YLIDENE)-1,3,5-HEPTATRIENYL]-1,3,3-TRIMETHYL-3H-INDOLIUM IODIDE;HITC IODIDE;1 1' 3 3 3' 3'-HEXAMETHYLINDOTRICARBO- &;1,1',3,3,3',3'-HEXAMETHYLINDOTRICARBO-CY ANINE IODIDE, 98% (LASER DYE);1,1',3,3,3',3'-HexaMethylindotricarbocyanine iodide 97%;1,1'',3,3,3'',3''-HEXAMETHYLINDOTRICARBO-CYANINE IODIDE, LASER GADE;HITC iodide, 2-[7-(1,3-Dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)-1,3,5-heptatrienyl]-1,3,3-trimethyl-3H-indolium iodide | | CAS: | 19764-96-6 | | MF: | C29H33IN2 | | MW: | 536.49 | | EINECS: | 243-282-2 | | Product Categories: | | | Mol File: | 19764-96-6.mol |  |
| | 1,1',3,3,3',3'-HEXAMETHYLINDOTRICARBOCYANINE IODIDE Chemical Properties |
| Melting point | 198 °C (dec.)(lit.) | | form | solid | | λmax | 740 nm | | InChI | 1S/C29H33N2.HI/c1-28(2)22-16-12-14-18-24(22)30(5)26(28)20-10-8-7-9-11-21-27-29(3,4)23-17-13-15-19-25(23)31(27)6;/h7-21H,1-6H3;1H/q+1;/p-1 | | InChIKey | JKXWXYURKUEZHV-UHFFFAOYSA-M | | SMILES | [I-].CN1c2ccccc2C(C)(C)\C1=C\C=C\C=C\C=C\C3=[N+](C)c4ccccc4C3(C)C | | EPA Substance Registry System | 3H-Indolium, 2-[7-(1,3-dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)-1,3,5-heptatrienyl]-1,3,3-trimethyl-, iodide (19764-96-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26-22 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 32049000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ACROS
| English |
| | 1,1',3,3,3',3'-HEXAMETHYLINDOTRICARBOCYANINE IODIDE Usage And Synthesis |
| Description | 1,1',3,3,3',3'-Hexamethylindotricarbocyanine iodide is a highly potent fluorescent dye widely utilized in biomedical research and proves invaluable for cell labeling and monitoring, as well as tracking cellular processes in real-time. This remarkable dye showcases exceptional aptitude in investigating mitochondrial function and dynamics. Furthermore, it boasts an ability to detect and precisely identify specific proteins and organelles residing within cells. Its diverse applications extend to dissecting ailments like cancer, neurodegenerative disorders, and even cardiovascular diseases. | | Chemical Properties | yellow-brown glistening powder | | Uses | Suitable as laser dye |
| | 1,1',3,3,3',3'-HEXAMETHYLINDOTRICARBOCYANINE IODIDE Preparation Products And Raw materials |
|