|
|
| | 2-chloro-3-nitro-5-(trifluoromethyl)benzoic acid Basic information |
| | 2-chloro-3-nitro-5-(trifluoromethyl)benzoic acid Chemical Properties |
| Boiling point | 329.8±42.0 °C(Predicted) | | density | 1.692±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 1.50±0.20(Predicted) | | Appearance | White to light yellow Solid | | InChIKey | PSRPKTROFCUEOD-UHFFFAOYSA-N | | SMILES | OC(C1=CC(C(F)(F)F)=CC([N+]([O-])=O)=C1Cl)=O |
| HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-chloro-3-nitro-5-(trifluoromethyl)benzoic acid Usage And Synthesis |
| | 2-chloro-3-nitro-5-(trifluoromethyl)benzoic acid Preparation Products And Raw materials |
|