4-Trifluoromethyl-piperidine-1,4-dicarboxylic acid mono-tert-butyl ester manufacturers
|
| | 4-Trifluoromethyl-piperidine-1,4-dicarboxylic acid mono-tert-butyl ester Basic information |
| Product Name: | 4-Trifluoromethyl-piperidine-1,4-dicarboxylic acid mono-tert-butyl ester | | Synonyms: | 4-Trifluoromethyl-piperidine-1,4-dicarboxylic acid mono-tert-butyl ester;1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethyl)piperidine-4-carboxylic acid;1,4-Piperidinedicarboxylic acid, 4-(trifluoromethyl)-, 1-(1,1-dimethylethyl) ester;N-BOC-4-TRIFLUOROMETHYLPIPERIDINE-4-CARBOXYLIC ACID;1-Boc-4-(trifluoromethyl)piperidine-4-carboxylic Acid | | CAS: | 495415-51-5 | | MF: | C12H18F3NO4 | | MW: | 297.27 | | EINECS: | | | Product Categories: | | | Mol File: | 495415-51-5.mol |  |
| | 4-Trifluoromethyl-piperidine-1,4-dicarboxylic acid mono-tert-butyl ester Chemical Properties |
| Boiling point | 347.4±42.0 °C(Predicted) | | density | 1.301±0.06 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | 1.86±0.20(Predicted) | | InChI | InChI=1S/C12H18F3NO4/c1-10(2,3)20-9(19)16-6-4-11(5-7-16,8(17)18)12(13,14)15/h4-7H2,1-3H3,(H,17,18) | | InChIKey | NECZIICXICWRHJ-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(C(F)(F)F)(C(O)=O)CC1 |
| | 4-Trifluoromethyl-piperidine-1,4-dicarboxylic acid mono-tert-butyl ester Usage And Synthesis |
| | 4-Trifluoromethyl-piperidine-1,4-dicarboxylic acid mono-tert-butyl ester Preparation Products And Raw materials |
|